ChemNet > CAS > 288252-38-0 1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
288252-38-0 1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
نام محصول |
1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride |
میدان مغناطیسی |
C11H8Cl2N2O |
وزن مولکولی |
255.1 |
InChI |
InChI=1/C11H8Cl2N2O/c1-7-10(11(13)16)6-14-15(7)9-4-2-8(12)3-5-9/h2-6H,1H3 |
شماره سیایاس |
288252-38-0 |
ساختار مولکولی |
|
تراکم |
1.39g/cm3 |
نقطه ذوب |
107℃ |
نقطه غلیان |
358.7°C at 760 mmHg |
ضریب شکست |
1.627 |
نقطه اشتعال |
170.7°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|